hannahgrace31511 hannahgrace31511

03-11-2021
Mathematics

contestada

A chef can finish a catering job in 4hr. His student can do the same job in 12hr. How long will it take them both to do the job if they work together

Respuesta :

shayy1616 shayy1616

03-11-2021

12 divided by 4 equal 3
Ans:3hrs

Answer Link

Otras preguntas

How did the actions of kink George 3rd and his parliament cause the American revolution?

calculate the length of AC

explain how the passage of Marco polo illustrates the limitations of intercultural knowledge and understanding

what is an lambic foot?

icks to surfaces such 10. You may have noticed that water sticks to surfaces as glass. Which property of water is responsible for this phenomenon?

PLEASE HELP PLEASE (thank you)Jenny's mother bought her two shirts (identical except for the color) and a small jewelry box that cost $8. she spent less than $3

Mrs. Wei was designing a 6 question True or False quiz. She didnot want there to be more than 2 answers the same in a row.How many ways could the answer key be

cosec(6b+pi/8)=sec(2b-pi/8)

Charlize was sitting at her desk playing on her phone as if she didn't have anything to do. * O simple O complex O compound-complex O compound

What is the denotation of the word gulping? ation of the word gulping? growing swallowing throwing away