jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

What Percent Of 700 Is 385

Suppose the slope of a line is positive. Describe what happens to the value of x as the value of y increases

To calculate the area of the front surface of a box,you (a) add the length to the height (b) add twice the length to twice the height ( c) multiply the length b

How do round, spiral, and rod-shaped bacteria look like?

what is 16,700,000,000,000,000 estimated as the product of a single digit and a power of 10

Select the product of (7x - 2)(7x + 7).

During a windstorm, part of the top of a flagpole breaks off. The broken top portion touches the ground at an angle of 65degrees 14feet from its base. How tall

How do you put 0.8918 as a fraction

Give an example of oxidation reaction which can be a nuisance

what are the similarities between insects and humans