viche8lbNEartino
viche8lbNEartino viche8lbNEartino
  • 03-03-2016
  • Social Studies
contestada

What is the currency of the United States?
A. English
B. pounds
C. dollar
D. money

Respuesta :

WorldCitizen WorldCitizen
  • 14-03-2016
The currency of the United States is called the US dollar - so the correct answer is C.


Pounds are found in the UK, and in some other countries, such as Egypt and Lebanon.

"money" is not a specific currency, but a more abstract term.

And English is the language, not currency of the US.
Answer Link
namekianball4
namekianball4 namekianball4
  • 19-11-2018

Dollar is the currency of the United States.

Hope it helps.

Answer Link

Otras preguntas

Lourdes wants to put molding around the edge of a rectangular frame that is 8 inches wide and 14 inches long. The molding costs $0.75 per inch. She buys 3 addit
What is nationalism? A.) Desire for democracy in a nation or country B.) Loyalty to a monarch of a country or nation C.) Patriotic pride in a nation or group D.
In 1997 dolly the sheep was cloned. which of the following processes was used?
cos(x/3)cos(x/3)=1/2(1+cos(2x/3))
A farmer wants to fence a section of land for a horse pasture. Fencing costs $27 per yard. How much will it cost to fence the pasture?
WHAT WORD GOES TO THIS DEFINITION: Protecting ecosystems and the organisms living in them.
C3H8+5O2a3CO2 +4H2O is an example of a __________ chemical reaction. A. synthesis. B. combustion. C. replacement. D. synthesis and combustion. E. synthesis and
7 copies of the sum of 8 fifths and 4
multiplier of a 44% increase
what is the definition of the term bail